C20H30O6 — CID 12824089
ethyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonanoate (PubChem CID 12824089) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is ethyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonanoate.
| Compound Name | ethyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonanoate |
|---|---|
| PubChem CID | 12824089 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl 9-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)nonanoate |
| SMILES | CCOC(=O)CCCCCCCCC1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C20H30O6/c1-5-26-16(21)13-11-9-7-6-8-10-12-15-14(2)17(22)19(24-3)20(25-4)18(15)23/h5-13H2,1-4H3 |
| InChIKey | HGPNNKDQTDZHDM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|