C12H12O4 — CID 12824133
(E)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enoic acid (PubChem CID 12824133) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (E)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 12824133 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (E)-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)prop-2-enoic acid |
| SMILES | CC1=C(C)C(=O)C(/C=C/C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C12H12O4/c1-6-7(2)12(16)9(4-5-10(13)14)8(3)11(6)15/h4-5H,1-3H3,(H,13,14)/b5-4+ |
| InChIKey | UFGFELQWXGECKU-SNAWJCMRSA-N |
| XLogP | 1.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|