About cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol
cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol (PubChem CID 12824761) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol |
| PubChem CID | 12824761 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol |
| SMILES | CC(C)=CNC(O)=C1C=CC=C1 |
| InChI | InChI=1S/C10H13NO/c1-8(2)7-11-10(12)9-5-3-4-6-9/h3-7,11-12H,1-2H3 |
| InChIKey | PJBZZQCRIDTZCO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol?
The IUPAC name of cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol (CID 12824761) is cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol.
What is the SMILES notation for cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol?
The canonical SMILES for cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol is CC(C)=CNC(O)=C1C=CC=C1.
What is the InChIKey of cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol?
The InChIKey is PJBZZQCRIDTZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8(2)7-11-10(12)9-5-3-4-6-9/h3-7,11-12H,1-2H3.
What are the key properties of cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol?
cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol has a molecular weight of 163.22 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-ylidene-(2-methylprop-1-enylamino)methanol is sourced from PubChem (CID 12824761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).