C14H20N2 — CID 12824843
1-[(2Z,4Z,6Z,8Z)-cyclonona-2,4,6,8-tetraen-1-ylidene]-N,N,N',N'-tetramethylmethanediamine (PubChem CID 12824843) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-[(2Z,4Z,6Z,8Z)-cyclonona-2,4,6,8-tetraen-1-ylidene]-N,N,N',N'-tetramethylmethanediamine.
| Compound Name | 1-[(2Z,4Z,6Z,8Z)-cyclonona-2,4,6,8-tetraen-1-ylidene]-N,N,N',N'-tetramethylmethanediamine |
|---|---|
| PubChem CID | 12824843 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-[(2Z,4Z,6Z,8Z)-cyclonona-2,4,6,8-tetraen-1-ylidene]-N,N,N',N'-tetramethylmethanediamine |
| SMILES | CN(C)C(=C1/C=C\C=C/C=C\C=C/1)N(C)C |
| InChI | InChI=1S/C14H20N2/c1-15(2)14(16(3)4)13-11-9-7-5-6-8-10-12-13/h5-12H,1-4H3/b7-5-,8-6-,11-9-,12-10- |
| InChIKey | DJSVSOIDVSNRIX-CAVFYFSLSA-N |
| XLogP | 2.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |