About 1-phenylpropan-2-yl carbamate
1-phenylpropan-2-yl carbamate (PubChem CID 12825) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-phenylpropan-2-yl carbamate.
Molecular Properties
| Compound Name | 1-phenylpropan-2-yl carbamate |
| PubChem CID | 12825 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-phenylpropan-2-yl carbamate |
| SMILES | CC(Cc1ccccc1)OC(N)=O |
| InChI | InChI=1S/C10H13NO2/c1-8(13-10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12) |
| InChIKey | QWJRGNMSAAHHJP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-2-yl carbamate?
The IUPAC name of 1-phenylpropan-2-yl carbamate (CID 12825) is 1-phenylpropan-2-yl carbamate.
What is the SMILES notation for 1-phenylpropan-2-yl carbamate?
The canonical SMILES for 1-phenylpropan-2-yl carbamate is CC(Cc1ccccc1)OC(N)=O.
What is the InChIKey of 1-phenylpropan-2-yl carbamate?
The InChIKey is QWJRGNMSAAHHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8(13-10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,11,12).
What are the key properties of 1-phenylpropan-2-yl carbamate?
1-phenylpropan-2-yl carbamate has a molecular weight of 179.22 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-2-yl carbamate is sourced from PubChem (CID 12825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).