C13H11N3O3S2 — CID 12826585
8-methyl-9,9-dioxo-9lambda6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11(15)-pentaen-14-one (PubChem CID 12826585) has the molecular formula C13H11N3O3S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 8-methyl-9,9-dioxo-9lambda6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11(15)-pentaen-14-one.
| Compound Name | 8-methyl-9,9-dioxo-9lambda6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11(15)-pentaen-14-one |
|---|---|
| PubChem CID | 12826585 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 8-methyl-9,9-dioxo-9lambda6,17-dithia-8,12,13-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2,4,6,11(15)-pentaen-14-one |
| SMILES | CN1c2ccccc2C2=C(c3[nH][nH]c(=O)c3CS2)S1(=O)=O |
| InChI | InChI=1S/C13H11N3O3S2/c1-16-9-5-3-2-4-7(9)11-12(21(16,18)19)10-8(6-20-11)13(17)15-14-10/h2-5H,6H2,1H3,(H2,14,15,17) |
| InChIKey | BMAKZGFGTJHSET-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |