About 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine
3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 12826602) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine.
Analyze 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine?
The IUPAC name of 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine (CID 12826602) is 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine.
What is the SMILES notation for 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine?
The canonical SMILES for 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine is C1CN=C2SCCN2C1.
What is the InChIKey of 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine?
The InChIKey is UZXKWLDYUXFLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-2-7-6-8(3-1)4-5-9-6/h1-5H2.
What are the key properties of 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine?
3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine has a molecular weight of 142.23 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6,7-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyrimidine is sourced from PubChem (CID 12826602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).