About N,N-di(cyclopenta-1,3-dien-1-yl)acetamide
N,N-di(cyclopenta-1,3-dien-1-yl)acetamide (PubChem CID 12826858) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is N,N-di(cyclopenta-1,3-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N,N-di(cyclopenta-1,3-dien-1-yl)acetamide |
| PubChem CID | 12826858 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N,N-di(cyclopenta-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)N(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C12H13NO/c1-10(14)13(11-6-2-3-7-11)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3 |
| InChIKey | PWOLKFZLTOSTBD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-di(cyclopenta-1,3-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(cyclopenta-1,3-dien-1-yl)acetamide?
The IUPAC name of N,N-di(cyclopenta-1,3-dien-1-yl)acetamide (CID 12826858) is N,N-di(cyclopenta-1,3-dien-1-yl)acetamide.
What is the SMILES notation for N,N-di(cyclopenta-1,3-dien-1-yl)acetamide?
The canonical SMILES for N,N-di(cyclopenta-1,3-dien-1-yl)acetamide is CC(=O)N(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of N,N-di(cyclopenta-1,3-dien-1-yl)acetamide?
The InChIKey is PWOLKFZLTOSTBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-10(14)13(11-6-2-3-7-11)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3.
What are the key properties of N,N-di(cyclopenta-1,3-dien-1-yl)acetamide?
N,N-di(cyclopenta-1,3-dien-1-yl)acetamide has a molecular weight of 187.24 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(cyclopenta-1,3-dien-1-yl)acetamide is sourced from PubChem (CID 12826858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).