About N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine
N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine (PubChem CID 12826859) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine |
| PubChem CID | 12826859 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine |
| SMILES | C1=CCC(NC2=CC=CC2)=C1 |
| InChI | InChI=1S/C10H11N/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-5,7,11H,6,8H2 |
| InChIKey | YWRUSOJIXJEYBV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine?
The IUPAC name of N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine (CID 12826859) is N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine?
The canonical SMILES for N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine is C1=CCC(NC2=CC=CC2)=C1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine?
The InChIKey is YWRUSOJIXJEYBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-5,7,11H,6,8H2.
What are the key properties of N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine?
N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine has a molecular weight of 145.20 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-amine is sourced from PubChem (CID 12826859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).