About N-cyclopenta-1,3-dien-1-ylacetamide
N-cyclopenta-1,3-dien-1-ylacetamide (PubChem CID 12826870) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylacetamide.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-ylacetamide |
| PubChem CID | 12826870 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylacetamide |
| SMILES | CC(=O)NC1=CC=CC1 |
| InChI | InChI=1S/C7H9NO/c1-6(9)8-7-4-2-3-5-7/h2-4H,5H2,1H3,(H,8,9) |
| InChIKey | AWMHDWWDOHOJOR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopenta-1,3-dien-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-ylacetamide?
The IUPAC name of N-cyclopenta-1,3-dien-1-ylacetamide (CID 12826870) is N-cyclopenta-1,3-dien-1-ylacetamide.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-ylacetamide?
The canonical SMILES for N-cyclopenta-1,3-dien-1-ylacetamide is CC(=O)NC1=CC=CC1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-ylacetamide?
The InChIKey is AWMHDWWDOHOJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-6(9)8-7-4-2-3-5-7/h2-4H,5H2,1H3,(H,8,9).
What are the key properties of N-cyclopenta-1,3-dien-1-ylacetamide?
N-cyclopenta-1,3-dien-1-ylacetamide has a molecular weight of 123.15 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-ylacetamide is sourced from PubChem (CID 12826870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).