About methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate
methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate (PubChem CID 12827045) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate |
| PubChem CID | 12827045 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate |
| SMILES | COC(=O)C1=CC(OC)OC1OC |
| InChI | InChI=1S/C8H12O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h4,6,8H,1-3H3 |
| InChIKey | TVAGUVQXWNNCPF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate?
The IUPAC name of methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate (CID 12827045) is methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate is COC(=O)C1=CC(OC)OC1OC.
What is the InChIKey of methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate?
The InChIKey is TVAGUVQXWNNCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-10-6-4-5(7(9)11-2)8(12-3)13-6/h4,6,8H,1-3H3.
What are the key properties of methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate?
methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate has a molecular weight of 188.18 g/mol, XLogP of 0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethoxy-2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 12827045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).