About 1-octylindole
1-octylindole (PubChem CID 12827273) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-octylindole.
Molecular Properties
| Compound Name | 1-octylindole |
| PubChem CID | 12827273 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-octylindole |
| SMILES | CCCCCCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C16H23N/c1-2-3-4-5-6-9-13-17-14-12-15-10-7-8-11-16(15)17/h7-8,10-12,14H,2-6,9,13H2,1H3 |
| InChIKey | VOWUHKQBOIRNJT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylindole?
The IUPAC name of 1-octylindole (CID 12827273) is 1-octylindole.
What is the SMILES notation for 1-octylindole?
The canonical SMILES for 1-octylindole is CCCCCCCCn1ccc2ccccc21.
What is the InChIKey of 1-octylindole?
The InChIKey is VOWUHKQBOIRNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-2-3-4-5-6-9-13-17-14-12-15-10-7-8-11-16(15)17/h7-8,10-12,14H,2-6,9,13H2,1H3.
What are the key properties of 1-octylindole?
1-octylindole has a molecular weight of 229.37 g/mol, XLogP of 5.00, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylindole is sourced from PubChem (CID 12827273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).