About 2,3-dichloro-5,6-dimethylpyrazine
2,3-dichloro-5,6-dimethylpyrazine (PubChem CID 12827800) has the molecular formula C6H6Cl2N2
and a molecular weight of 177.03 g/mol. Its IUPAC name is 2,3-dichloro-5,6-dimethylpyrazine.
Molecular Properties
| Compound Name | 2,3-dichloro-5,6-dimethylpyrazine |
| PubChem CID | 12827800 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | 2,3-dichloro-5,6-dimethylpyrazine |
| SMILES | Cc1nc(Cl)c(Cl)nc1C |
| InChI | InChI=1S/C6H6Cl2N2/c1-3-4(2)10-6(8)5(7)9-3/h1-2H3 |
| InChIKey | ZSOPOANLAMBETK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dichloro-5,6-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-5,6-dimethylpyrazine?
The IUPAC name of 2,3-dichloro-5,6-dimethylpyrazine (CID 12827800) is 2,3-dichloro-5,6-dimethylpyrazine.
What is the SMILES notation for 2,3-dichloro-5,6-dimethylpyrazine?
The canonical SMILES for 2,3-dichloro-5,6-dimethylpyrazine is Cc1nc(Cl)c(Cl)nc1C.
What is the InChIKey of 2,3-dichloro-5,6-dimethylpyrazine?
The InChIKey is ZSOPOANLAMBETK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2/c1-3-4(2)10-6(8)5(7)9-3/h1-2H3.
What are the key properties of 2,3-dichloro-5,6-dimethylpyrazine?
2,3-dichloro-5,6-dimethylpyrazine has a molecular weight of 177.03 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-5,6-dimethylpyrazine is sourced from PubChem (CID 12827800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).