About (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate
(1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate (PubChem CID 12827823) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate.
Molecular Properties
| Compound Name | (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate |
| PubChem CID | 12827823 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate |
| SMILES | COc1ccc(/C(c2ccccc2)=[N+]2\N=C([O-])N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H17N3O3/c1-28-19-14-12-17(13-15-19)20(16-8-4-2-5-9-16)25-22(27)24(21(26)23-25)18-10-6-3-7-11-18/h2-15H,1H3/b25-20- |
| InChIKey | ZUXXUWLVXRPUHX-QQTULTPQSA-N |
| XLogP | 2.82 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate?
The IUPAC name of (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate (CID 12827823) is (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate.
What is the SMILES notation for (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate?
The canonical SMILES for (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate is COc1ccc(/C(c2ccccc2)=[N+]2\N=C([O-])N(c3ccccc3)C2=O)cc1.
What is the InChIKey of (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate?
The InChIKey is ZUXXUWLVXRPUHX-QQTULTPQSA-N. The full InChI is InChI=1S/C22H17N3O3/c1-28-19-14-12-17(13-15-19)20(16-8-4-2-5-9-16)25-22(27)24(21(26)23-25)18-10-6-3-7-11-18/h2-15H,1H3/b25-20-.
What are the key properties of (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate?
(1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate has a molecular weight of 371.40 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-[(4-methoxyphenyl)-phenylmethylidene]-5-oxo-4-phenyl-1,2,4-triazol-1-ium-3-olate is sourced from PubChem (CID 12827823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).