C10H15Cl3Zr- — CID 12827918
1,2,3,4,5-pentamethylcyclopenta-1,3-diene;trichlorozirconium (PubChem CID 12827918) has the molecular formula C10H15Cl3Zr- and a molecular weight of 332.81 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;trichlorozirconium.
| Compound Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;trichlorozirconium |
|---|---|
| PubChem CID | 12827918 |
| Molecular Formula | C10H15Cl3Zr- |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;trichlorozirconium |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cl[Zr](Cl)Cl |
| InChI | InChI=1S/C10H15.3ClH.Zr/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q-1;;;;+3/p-3 |
| InChIKey | XZRIJZMMTDVZIR-UHFFFAOYSA-K |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|