C10H9F11S — CID 12828094
3-tert-butylsulfanyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene (PubChem CID 12828094) has the molecular formula C10H9F11S and a molecular weight of 370.23 g/mol. Its IUPAC name is 3-tert-butylsulfanyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 3-tert-butylsulfanyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12828094 |
| Molecular Formula | C10H9F11S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-tert-butylsulfanyl-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)(C)SC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11S/c1-6(2,3)22-5(7(11,12)10(19,20)21)4(8(13,14)15)9(16,17)18/h1-3H3 |
| InChIKey | ZTKBGDXVVDOUKP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|