C8H6F10S — CID 12828099
(E)-3-ethylsulfanyl-1,1,1,2,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene (PubChem CID 12828099) has the molecular formula C8H6F10S and a molecular weight of 324.18 g/mol. Its IUPAC name is (E)-3-ethylsulfanyl-1,1,1,2,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-3-ethylsulfanyl-1,1,1,2,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12828099 |
| Molecular Formula | C8H6F10S |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | (E)-3-ethylsulfanyl-1,1,1,2,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
| SMILES | CCS/C(=C(/F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F10S/c1-2-19-3(5(9)8(16,17)18)4(6(10,11)12)7(13,14)15/h4H,2H2,1H3/b5-3+ |
| InChIKey | NPKKBLNREIUQDF-HWKANZROSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |