C12F22S2 — CID 12828102
1,1,1,4,4,5,5,5-octafluoro-3-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]disulfanyl]-2-(trifluoromethyl)pent-2-ene (PubChem CID 12828102) has the molecular formula C12F22S2 and a molecular weight of 626.22 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-3-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]disulfanyl]-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-3-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]disulfanyl]-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 12828102 |
| Molecular Formula | C12F22S2 |
| Molecular Weight | 626.22 g/mol |
| Exact Mass | 625.91 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-3-[[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]disulfanyl]-2-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)C(=C(SSC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F22S2/c13-5(14,11(29,30)31)3(1(7(17,18)19)8(20,21)22)35-36-4(6(15,16)12(32,33)34)2(9(23,24)25)10(26,27)28 |
| InChIKey | BLOLIOVUNJCYMV-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.22 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|