About 3-methoxybutanenitrile
3-methoxybutanenitrile (PubChem CID 12828792) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 3-methoxybutanenitrile.
Molecular Properties
| Compound Name | 3-methoxybutanenitrile |
| PubChem CID | 12828792 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 3-methoxybutanenitrile |
| SMILES | COC(C)CC#N |
| InChI | InChI=1S/C5H9NO/c1-5(7-2)3-4-6/h5H,3H2,1-2H3 |
| InChIKey | WOAZYIVRCPMLHX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutanenitrile?
The IUPAC name of 3-methoxybutanenitrile (CID 12828792) is 3-methoxybutanenitrile.
What is the SMILES notation for 3-methoxybutanenitrile?
The canonical SMILES for 3-methoxybutanenitrile is COC(C)CC#N.
What is the InChIKey of 3-methoxybutanenitrile?
The InChIKey is WOAZYIVRCPMLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-5(7-2)3-4-6/h5H,3H2,1-2H3.
What are the key properties of 3-methoxybutanenitrile?
3-methoxybutanenitrile has a molecular weight of 99.13 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutanenitrile is sourced from PubChem (CID 12828792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).