About butanimidamide;hydrochloride
butanimidamide;hydrochloride (PubChem CID 12828983) has the molecular formula C4H11ClN2
and a molecular weight of 122.60 g/mol. Its IUPAC name is butanimidamide;hydrochloride.
Molecular Properties
| Compound Name | butanimidamide;hydrochloride |
| PubChem CID | 12828983 |
| Molecular Formula | C4H11ClN2 |
| Molecular Weight | 122.60 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | butanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N)CCC |
| InChI | InChI=1S/C4H10N2.ClH/c1-2-3-4(5)6;/h2-3H2,1H3,(H3,5,6);1H |
| InChIKey | STYCVEYASXULRN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.60 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanimidamide;hydrochloride?
The IUPAC name of butanimidamide;hydrochloride (CID 12828983) is butanimidamide;hydrochloride.
What is the SMILES notation for butanimidamide;hydrochloride?
The canonical SMILES for butanimidamide;hydrochloride is Cl.[H]/N=C(/N)CCC.
What is the InChIKey of butanimidamide;hydrochloride?
The InChIKey is STYCVEYASXULRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.ClH/c1-2-3-4(5)6;/h2-3H2,1H3,(H3,5,6);1H.
What are the key properties of butanimidamide;hydrochloride?
butanimidamide;hydrochloride has a molecular weight of 122.60 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanimidamide;hydrochloride is sourced from PubChem (CID 12828983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).