About 3-methyl-1,1-di(propan-2-yl)urea
3-methyl-1,1-di(propan-2-yl)urea (PubChem CID 12829062) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-methyl-1,1-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 3-methyl-1,1-di(propan-2-yl)urea |
| PubChem CID | 12829062 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 3-methyl-1,1-di(propan-2-yl)urea |
| SMILES | CNC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C8H18N2O/c1-6(2)10(7(3)4)8(11)9-5/h6-7H,1-5H3,(H,9,11) |
| InChIKey | KLQJNOCNJVNMGM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1,1-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-di(propan-2-yl)urea?
The IUPAC name of 3-methyl-1,1-di(propan-2-yl)urea (CID 12829062) is 3-methyl-1,1-di(propan-2-yl)urea.
What is the SMILES notation for 3-methyl-1,1-di(propan-2-yl)urea?
The canonical SMILES for 3-methyl-1,1-di(propan-2-yl)urea is CNC(=O)N(C(C)C)C(C)C.
What is the InChIKey of 3-methyl-1,1-di(propan-2-yl)urea?
The InChIKey is KLQJNOCNJVNMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-6(2)10(7(3)4)8(11)9-5/h6-7H,1-5H3,(H,9,11).
What are the key properties of 3-methyl-1,1-di(propan-2-yl)urea?
3-methyl-1,1-di(propan-2-yl)urea has a molecular weight of 158.24 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-di(propan-2-yl)urea is sourced from PubChem (CID 12829062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).