About 1,1,3-tri(propan-2-yl)urea
1,1,3-tri(propan-2-yl)urea (PubChem CID 12829063) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,1,3-tri(propan-2-yl)urea.
Molecular Properties
| Compound Name | 1,1,3-tri(propan-2-yl)urea |
| PubChem CID | 12829063 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1,1,3-tri(propan-2-yl)urea |
| SMILES | CC(C)NC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(2)11-10(13)12(8(3)4)9(5)6/h7-9H,1-6H3,(H,11,13) |
| InChIKey | RAQKUUNDXWNXMX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3-tri(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-tri(propan-2-yl)urea?
The IUPAC name of 1,1,3-tri(propan-2-yl)urea (CID 12829063) is 1,1,3-tri(propan-2-yl)urea.
What is the SMILES notation for 1,1,3-tri(propan-2-yl)urea?
The canonical SMILES for 1,1,3-tri(propan-2-yl)urea is CC(C)NC(=O)N(C(C)C)C(C)C.
What is the InChIKey of 1,1,3-tri(propan-2-yl)urea?
The InChIKey is RAQKUUNDXWNXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-7(2)11-10(13)12(8(3)4)9(5)6/h7-9H,1-6H3,(H,11,13).
What are the key properties of 1,1,3-tri(propan-2-yl)urea?
1,1,3-tri(propan-2-yl)urea has a molecular weight of 186.30 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-tri(propan-2-yl)urea is sourced from PubChem (CID 12829063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).