About hept-6-en-3-yn-2-ol
hept-6-en-3-yn-2-ol (PubChem CID 12829377) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is hept-6-en-3-yn-2-ol.
Molecular Properties
| Compound Name | hept-6-en-3-yn-2-ol |
| PubChem CID | 12829377 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | hept-6-en-3-yn-2-ol |
| SMILES | C=CCC#CC(C)O |
| InChI | InChI=1S/C7H10O/c1-3-4-5-6-7(2)8/h3,7-8H,1,4H2,2H3 |
| InChIKey | VHQQQIOJZDBEGH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-6-en-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-en-3-yn-2-ol?
The IUPAC name of hept-6-en-3-yn-2-ol (CID 12829377) is hept-6-en-3-yn-2-ol.
What is the SMILES notation for hept-6-en-3-yn-2-ol?
The canonical SMILES for hept-6-en-3-yn-2-ol is C=CCC#CC(C)O.
What is the InChIKey of hept-6-en-3-yn-2-ol?
The InChIKey is VHQQQIOJZDBEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-3-4-5-6-7(2)8/h3,7-8H,1,4H2,2H3.
What are the key properties of hept-6-en-3-yn-2-ol?
hept-6-en-3-yn-2-ol has a molecular weight of 110.16 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-en-3-yn-2-ol is sourced from PubChem (CID 12829377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).