C4H2Cl2F6 — CID 12829383
4,4-dichloro-1,1,1,2,3,3-hexafluorobutane (PubChem CID 12829383) has the molecular formula C4H2Cl2F6 and a molecular weight of 234.95 g/mol. Its IUPAC name is 4,4-dichloro-1,1,1,2,3,3-hexafluorobutane.
| Compound Name | 4,4-dichloro-1,1,1,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 12829383 |
| Molecular Formula | C4H2Cl2F6 |
| Molecular Weight | 234.95 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 4,4-dichloro-1,1,1,2,3,3-hexafluorobutane |
| SMILES | FC(C(F)(F)F)C(F)(F)C(Cl)Cl |
| InChI | InChI=1S/C4H2Cl2F6/c5-2(6)3(8,9)1(7)4(10,11)12/h1-2H |
| InChIKey | WCZYIXIGTVJBKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.95 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|