C5H3ClF6 — CID 12829405
3-[chloro(difluoro)methyl]-3,4,4,4-tetrafluorobut-1-ene (PubChem CID 12829405) has the molecular formula C5H3ClF6 and a molecular weight of 212.52 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-3,4,4,4-tetrafluorobut-1-ene.
| Compound Name | 3-[chloro(difluoro)methyl]-3,4,4,4-tetrafluorobut-1-ene |
|---|---|
| PubChem CID | 12829405 |
| Molecular Formula | C5H3ClF6 |
| Molecular Weight | 212.52 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-3,4,4,4-tetrafluorobut-1-ene |
| SMILES | C=CC(F)(C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C5H3ClF6/c1-2-3(7,4(6,8)9)5(10,11)12/h2H,1H2 |
| InChIKey | LVSNWRUTYXJAOC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|