C5H4Cl2F6 — CID 12829420
1,4-dichloro-1,1,2-trifluoro-2-(trifluoromethyl)butane (PubChem CID 12829420) has the molecular formula C5H4Cl2F6 and a molecular weight of 248.98 g/mol. Its IUPAC name is 1,4-dichloro-1,1,2-trifluoro-2-(trifluoromethyl)butane.
| Compound Name | 1,4-dichloro-1,1,2-trifluoro-2-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 12829420 |
| Molecular Formula | C5H4Cl2F6 |
| Molecular Weight | 248.98 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1,4-dichloro-1,1,2-trifluoro-2-(trifluoromethyl)butane |
| SMILES | FC(F)(F)C(F)(CCCl)C(F)(F)Cl |
| InChI | InChI=1S/C5H4Cl2F6/c6-2-1-3(8,4(7,9)10)5(11,12)13/h1-2H2 |
| InChIKey | HMDSNBMRQKHEPP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|