3,5-dimethylhexanoic acid

C8H16O2 — CID 12830075

IUPAC3,5-dimethylhexanoic acid
SMILESCC(C)CC(C)CC(=O)O
InChIInChI=1S/C8H16O2/c1-6(2)4-7(3)5-8(9)10/h6-7H,4-5H2,1-3H3,(H,9,10)
InChIKeyKTWWTCBUJPAASC-UHFFFAOYSA-N
MW144.21 g/mol
LogP2.14
Rot. Bonds4

About 3,5-dimethylhexanoic acid

3,5-dimethylhexanoic acid (PubChem CID 12830075) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 3,5-dimethylhexanoic acid.

Molecular Properties

Compound Name3,5-dimethylhexanoic acid
PubChem CID12830075
Molecular FormulaC8H16O2
Molecular Weight144.21 g/mol
Exact Mass144.12
IUPAC Name3,5-dimethylhexanoic acid
SMILESCC(C)CC(C)CC(=O)O
InChIInChI=1S/C8H16O2/c1-6(2)4-7(3)5-8(9)10/h6-7H,4-5H2,1-3H3,(H,9,10)
InChIKeyKTWWTCBUJPAASC-UHFFFAOYSA-N
XLogP2.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.21
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,5-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethylhexanoic acid?
The IUPAC name of 3,5-dimethylhexanoic acid (CID 12830075) is 3,5-dimethylhexanoic acid.
What is the SMILES notation for 3,5-dimethylhexanoic acid?
The canonical SMILES for 3,5-dimethylhexanoic acid is CC(C)CC(C)CC(=O)O.
What is the InChIKey of 3,5-dimethylhexanoic acid?
The InChIKey is KTWWTCBUJPAASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-6(2)4-7(3)5-8(9)10/h6-7H,4-5H2,1-3H3,(H,9,10).
What are the key properties of 3,5-dimethylhexanoic acid?
3,5-dimethylhexanoic acid has a molecular weight of 144.21 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylhexanoic acid is sourced from PubChem (CID 12830075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).