C20H16N4O3 — CID 12830569
ethyl 2-cyano-3-(1,5-diphenyl-1,2,4-triazol-3-yl)-3-oxopropanoate (PubChem CID 12830569) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is ethyl 2-cyano-3-(1,5-diphenyl-1,2,4-triazol-3-yl)-3-oxopropanoate.
| Compound Name | ethyl 2-cyano-3-(1,5-diphenyl-1,2,4-triazol-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 12830569 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl 2-cyano-3-(1,5-diphenyl-1,2,4-triazol-3-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C#N)C(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H16N4O3/c1-2-27-20(26)16(13-21)17(25)18-22-19(14-9-5-3-6-10-14)24(23-18)15-11-7-4-8-12-15/h3-12,16H,2H2,1H3 |
| InChIKey | PASPBSYHYFNVBV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|