About 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide
2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide (PubChem CID 128311929) has the molecular formula C8H11FN2O2
and a molecular weight of 186.18 g/mol. Its IUPAC name is 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide.
Molecular Properties
| Compound Name | 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide |
| PubChem CID | 128311929 |
| Molecular Formula | C8H11FN2O2 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)N1CCC=C(C1)F |
| InChI | InChI=1S/C8H11FN2O2/c1-10-7(12)8(13)11-4-2-3-6(9)5-11/h3H,2,4-5H2,1H3,(H,10,12) |
| InChIKey | FFOCYFOUFIEXMR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 263 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide?
The IUPAC name of 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide (CID 128311929) is 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide.
What is the SMILES notation for 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide?
The canonical SMILES for 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide is CNC(=O)C(=O)N1CCC=C(C1)F.
What is the InChIKey of 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide?
The InChIKey is FFOCYFOUFIEXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2/c1-10-7(12)8(13)11-4-2-3-6(9)5-11/h3H,2,4-5H2,1H3,(H,10,12).
What are the key properties of 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide?
2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide has a molecular weight of 186.18 g/mol, XLogP of -0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-N-methyl-2-oxoacetamide is sourced from PubChem (CID 128311929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).