C19H9Cl2F6N — CID 12831598
2,3-bis(4-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)pyrrole (PubChem CID 12831598) has the molecular formula C19H9Cl2F6N and a molecular weight of 436.18 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)pyrrole.
| Compound Name | 2,3-bis(4-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)pyrrole |
|---|---|
| PubChem CID | 12831598 |
| Molecular Formula | C19H9Cl2F6N |
| Molecular Weight | 436.18 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)pyrrole |
| SMILES | FC(F)(F)C(=C1C=C(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)=N1)C(F)(F)F |
| InChI | InChI=1S/C19H9Cl2F6N/c20-12-5-1-10(2-6-12)14-9-15(17(18(22,23)24)19(25,26)27)28-16(14)11-3-7-13(21)8-4-11/h1-9H |
| InChIKey | ZARBXAGVHPLKIT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.18 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |