C15H24N4O2S — CID 12831797
N-[2-(diethylamino)ethyl]-N'-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide (PubChem CID 12831797) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 12831797 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H24N4O2S/c1-3-19(4-2)10-9-16-13(20)14(21)18-15-17-11-7-5-6-8-12(11)22-15/h3-10H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | ZLBDSCYMUIXPNR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|