C23H31IN2O2 — CID 12831928
N-[2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)ethyl]phenyl]-4-methoxybenzamide iodide (PubChem CID 12831928) has the molecular formula C23H31IN2O2 and a molecular weight of 494.42 g/mol. Its IUPAC name is N-[2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)ethyl]phenyl]-4-methoxybenzamide iodide.
| Compound Name | N-[2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)ethyl]phenyl]-4-methoxybenzamide iodide |
|---|---|
| PubChem CID | 12831928 |
| Molecular Formula | C23H31IN2O2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[2-[2-(1,1-dimethylpiperidin-1-ium-2-yl)ethyl]phenyl]-4-methoxybenzamide iodide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2CCC2CCCC[N+]2(C)C)cc1.[I-] |
| InChI | InChI=1S/C23H30N2O2.HI/c1-25(2)17-7-6-9-20(25)14-11-18-8-4-5-10-22(18)24-23(26)19-12-15-21(27-3)16-13-19;/h4-5,8,10,12-13,15-16,20H,6-7,9,11,14,17H2,1-3H3;1H |
| InChIKey | VOGFBLDDNZRUDZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|