C20H24O3S — CID 12832515
prop-2-enyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate (PubChem CID 12832515) has the molecular formula C20H24O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is prop-2-enyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate.
| Compound Name | prop-2-enyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
|---|---|
| PubChem CID | 12832515 |
| Molecular Formula | C20H24O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | prop-2-enyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
| SMILES | C=CCOC(=O)C(C)c1ccc2c(c1)SCC1CCCCC1C2=O |
| InChI | InChI=1S/C20H24O3S/c1-3-10-23-20(22)13(2)14-8-9-17-18(11-14)24-12-15-6-4-5-7-16(15)19(17)21/h3,8-9,11,13,15-16H,1,4-7,10,12H2,2H3 |
| InChIKey | VAFAGZWDOTXSIX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|