C21H28O3S — CID 12832526
butyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate (PubChem CID 12832526) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is butyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate.
| Compound Name | butyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
|---|---|
| PubChem CID | 12832526 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | butyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
| SMILES | CCCCOC(=O)C(C)c1ccc2c(c1)SCC1CCCCC1C2=O |
| InChI | InChI=1S/C21H28O3S/c1-3-4-11-24-21(23)14(2)15-9-10-18-19(12-15)25-13-16-7-5-6-8-17(16)20(18)22/h9-10,12,14,16-17H,3-8,11,13H2,1-2H3 |
| InChIKey | OBCLUYQALDBUAD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|