C21H28O4S — CID 12832548
2-ethoxyethyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate (PubChem CID 12832548) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate.
| Compound Name | 2-ethoxyethyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
|---|---|
| PubChem CID | 12832548 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-ethoxyethyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
| SMILES | CCOCCOC(=O)C(C)c1ccc2c(c1)SCC1CCCCC1C2=O |
| InChI | InChI=1S/C21H28O4S/c1-3-24-10-11-25-21(23)14(2)15-8-9-18-19(12-15)26-13-16-6-4-5-7-17(16)20(18)22/h8-9,12,14,16-17H,3-7,10-11,13H2,1-2H3 |
| InChIKey | ULAOQWBWDVCIMV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|