About sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione
sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (PubChem CID 12832575) has the molecular formula C11H17N2NaO2S
and a molecular weight of 264.33 g/mol. Its IUPAC name is sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
Molecular Properties
| Compound Name | sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| PubChem CID | 12832575 |
| Molecular Formula | C11H17N2NaO2S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| SMILES | CCCC(C)C1(CC)C(=O)[N-]C(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O2S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| InChIKey | AWLILQARPMWUHA-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The IUPAC name of sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (CID 12832575) is sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
What is the SMILES notation for sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The canonical SMILES for sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione is CCCC(C)C1(CC)C(=O)[N-]C(=S)NC1=O.[Na+].
What is the InChIKey of sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The InChIKey is AWLILQARPMWUHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18N2O2S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1.
What are the key properties of sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione has a molecular weight of 264.33 g/mol, XLogP of -0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-ethyl-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione is sourced from PubChem (CID 12832575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).