About 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine
5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine (PubChem CID 12834621) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine |
| PubChem CID | 12834621 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine |
| SMILES | CCOC1=NCCNC(c2ccccc2)=C1 |
| InChI | InChI=1S/C13H16N2O/c1-2-16-13-10-12(14-8-9-15-13)11-6-4-3-5-7-11/h3-7,10,14H,2,8-9H2,1H3 |
| InChIKey | XDVQKVNILNZRFH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine?
The IUPAC name of 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine (CID 12834621) is 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine.
What is the SMILES notation for 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine?
The canonical SMILES for 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine is CCOC1=NCCNC(c2ccccc2)=C1.
What is the InChIKey of 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine?
The InChIKey is XDVQKVNILNZRFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-2-16-13-10-12(14-8-9-15-13)11-6-4-3-5-7-11/h3-7,10,14H,2,8-9H2,1H3.
What are the key properties of 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine?
5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine has a molecular weight of 216.28 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-7-phenyl-2,3-dihydro-1H-1,4-diazepine is sourced from PubChem (CID 12834621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).