About methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate
methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 12835111) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 12835111 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(OC)C=C1OC |
| InChI | InChI=1S/C10H14O4/c1-12-7-4-5-8(10(11)14-3)9(6-7)13-2/h4,6,8H,5H2,1-3H3 |
| InChIKey | NCCCIAIYPUQJJI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate (CID 12835111) is methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate is COC(=O)C1CC=C(OC)C=C1OC.
What is the InChIKey of methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is NCCCIAIYPUQJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-12-7-4-5-8(10(11)14-3)9(6-7)13-2/h4,6,8H,5H2,1-3H3.
What are the key properties of methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate?
methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethoxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 12835111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).