About 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane
1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane (PubChem CID 12835611) has the molecular formula C10H22O4S2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane |
| PubChem CID | 12835611 |
| Molecular Formula | C10H22O4S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane |
| SMILES | CC(C)(C)CS(=O)(=O)S(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H22O4S2/c1-9(2,3)7-15(11,12)16(13,14)8-10(4,5)6/h7-8H2,1-6H3 |
| InChIKey | OOFZSXVZUHFMJO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane?
The IUPAC name of 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane (CID 12835611) is 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane.
What is the SMILES notation for 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane?
The canonical SMILES for 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane is CC(C)(C)CS(=O)(=O)S(=O)(=O)CC(C)(C)C.
What is the InChIKey of 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane?
The InChIKey is OOFZSXVZUHFMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4S2/c1-9(2,3)7-15(11,12)16(13,14)8-10(4,5)6/h7-8H2,1-6H3.
What are the key properties of 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane?
1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane has a molecular weight of 270.42 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropylsulfonylsulfonyl)-2,2-dimethylpropane is sourced from PubChem (CID 12835611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).