About 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate
2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate (PubChem CID 12835612) has the molecular formula C10H22O5S2
and a molecular weight of 286.41 g/mol. Its IUPAC name is 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate.
Molecular Properties
| Compound Name | 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate |
| PubChem CID | 12835612 |
| Molecular Formula | C10H22O5S2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(C)(C)CS(=O)(=O)OS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H22O5S2/c1-9(2,3)7-16(11,12)15-17(13,14)8-10(4,5)6/h7-8H2,1-6H3 |
| InChIKey | ZMRIJANMVBDREA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate?
The IUPAC name of 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate (CID 12835612) is 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate.
What is the SMILES notation for 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate?
The canonical SMILES for 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate is CC(C)(C)CS(=O)(=O)OS(=O)(=O)CC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate?
The InChIKey is ZMRIJANMVBDREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O5S2/c1-9(2,3)7-16(11,12)15-17(13,14)8-10(4,5)6/h7-8H2,1-6H3.
What are the key properties of 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate?
2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate has a molecular weight of 286.41 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropylsulfonyl 2,2-dimethylpropane-1-sulfonate is sourced from PubChem (CID 12835612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).