C23H25NO — CID 1283569
1-ethyl-3,5-bis[(2-methylphenyl)methylidene]piperidin-4-one (PubChem CID 1283569) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-ethyl-3,5-bis[(2-methylphenyl)methylidene]piperidin-4-one.
| Compound Name | 1-ethyl-3,5-bis[(2-methylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 1283569 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-ethyl-3,5-bis[(2-methylphenyl)methylidene]piperidin-4-one |
| SMILES | CCN1CC(=Cc2ccccc2C)C(=O)C(=Cc2ccccc2C)C1 |
| InChI | InChI=1S/C23H25NO/c1-4-24-15-21(13-19-11-7-5-9-17(19)2)23(25)22(16-24)14-20-12-8-6-10-18(20)3/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | NUVNZDFXVCESAL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|