C11H15N — CID 12835985
3-methyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 12835985) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-methyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | 3-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 12835985 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | Cc1cc2c(cc1N)CCCC2 |
| InChI | InChI=1S/C11H15N/c1-8-6-9-4-2-3-5-10(9)7-11(8)12/h6-7H,2-5,12H2,1H3 |
| InChIKey | LNHSFPWITZFNGO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|