About 1,1-di(butan-2-yl)urea
1,1-di(butan-2-yl)urea (PubChem CID 12836295) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1,1-di(butan-2-yl)urea.
Molecular Properties
| Compound Name | 1,1-di(butan-2-yl)urea |
| PubChem CID | 12836295 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1,1-di(butan-2-yl)urea |
| SMILES | CCC(C)N(C(N)=O)C(C)CC |
| InChI | InChI=1S/C9H20N2O/c1-5-7(3)11(9(10)12)8(4)6-2/h7-8H,5-6H2,1-4H3,(H2,10,12) |
| InChIKey | FTPSXMKMTGZCJB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-di(butan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(butan-2-yl)urea?
The IUPAC name of 1,1-di(butan-2-yl)urea (CID 12836295) is 1,1-di(butan-2-yl)urea.
What is the SMILES notation for 1,1-di(butan-2-yl)urea?
The canonical SMILES for 1,1-di(butan-2-yl)urea is CCC(C)N(C(N)=O)C(C)CC.
What is the InChIKey of 1,1-di(butan-2-yl)urea?
The InChIKey is FTPSXMKMTGZCJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-5-7(3)11(9(10)12)8(4)6-2/h7-8H,5-6H2,1-4H3,(H2,10,12).
What are the key properties of 1,1-di(butan-2-yl)urea?
1,1-di(butan-2-yl)urea has a molecular weight of 172.27 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(butan-2-yl)urea is sourced from PubChem (CID 12836295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).