About 2-methylsulfanylbuta-1,3-diene
2-methylsulfanylbuta-1,3-diene (PubChem CID 12836304) has the molecular formula C5H8S
and a molecular weight of 100.19 g/mol. Its IUPAC name is 2-methylsulfanylbuta-1,3-diene.
Molecular Properties
| Compound Name | 2-methylsulfanylbuta-1,3-diene |
| PubChem CID | 12836304 |
| Molecular Formula | C5H8S |
| Molecular Weight | 100.19 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | 2-methylsulfanylbuta-1,3-diene |
| SMILES | C=CC(=C)SC |
| InChI | InChI=1S/C5H8S/c1-4-5(2)6-3/h4H,1-2H2,3H3 |
| InChIKey | MHCTWEGHIQDHLS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylbuta-1,3-diene?
The IUPAC name of 2-methylsulfanylbuta-1,3-diene (CID 12836304) is 2-methylsulfanylbuta-1,3-diene.
What is the SMILES notation for 2-methylsulfanylbuta-1,3-diene?
The canonical SMILES for 2-methylsulfanylbuta-1,3-diene is C=CC(=C)SC.
What is the InChIKey of 2-methylsulfanylbuta-1,3-diene?
The InChIKey is MHCTWEGHIQDHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8S/c1-4-5(2)6-3/h4H,1-2H2,3H3.
What are the key properties of 2-methylsulfanylbuta-1,3-diene?
2-methylsulfanylbuta-1,3-diene has a molecular weight of 100.19 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylbuta-1,3-diene is sourced from PubChem (CID 12836304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).