C11H14S — CID 12836417
(1-ethylcyclopropyl)sulfanylbenzene (PubChem CID 12836417) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is (1-ethylcyclopropyl)sulfanylbenzene.
| Compound Name | (1-ethylcyclopropyl)sulfanylbenzene |
|---|---|
| PubChem CID | 12836417 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (1-ethylcyclopropyl)sulfanylbenzene |
| SMILES | CCC1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C11H14S/c1-2-11(8-9-11)12-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | IVZVMEZSPJEPIP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |