About N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide
N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide (PubChem CID 12836731) has the molecular formula C16H20ClNO4
and a molecular weight of 325.79 g/mol. Its IUPAC name is N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide |
| PubChem CID | 12836731 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide |
| SMILES | CCOCC(=O)N(c1c(C)ccc(Cl)c1C)C1CCOC1=O |
| InChI | InChI=1S/C16H20ClNO4/c1-4-21-9-14(19)18(13-7-8-22-16(13)20)15-10(2)5-6-12(17)11(15)3/h5-6,13H,4,7-9H2,1-3H3 |
| InChIKey | PVNBMAJAXLQGAI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide?
The IUPAC name of N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide (CID 12836731) is N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide.
What is the SMILES notation for N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide?
The canonical SMILES for N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide is CCOCC(=O)N(c1c(C)ccc(Cl)c1C)C1CCOC1=O.
What is the InChIKey of N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide?
The InChIKey is PVNBMAJAXLQGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO4/c1-4-21-9-14(19)18(13-7-8-22-16(13)20)15-10(2)5-6-12(17)11(15)3/h5-6,13H,4,7-9H2,1-3H3.
What are the key properties of N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide?
N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide has a molecular weight of 325.79 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,6-dimethylphenyl)-2-ethoxy-N-(2-oxooxolan-3-yl)acetamide is sourced from PubChem (CID 12836731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).