About 2-(benzotriazol-2-yl)-4,6-dibutylphenol
2-(benzotriazol-2-yl)-4,6-dibutylphenol (PubChem CID 12837390) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4,6-dibutylphenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-4,6-dibutylphenol |
| PubChem CID | 12837390 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-dibutylphenol |
| SMILES | CCCCc1cc(CCCC)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-3-5-9-15-13-16(10-6-4-2)20(24)19(14-15)23-21-17-11-7-8-12-18(17)22-23/h7-8,11-14,24H,3-6,9-10H2,1-2H3 |
| InChIKey | IJLQBCRKBCAKNJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-2-yl)-4,6-dibutylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-4,6-dibutylphenol?
The IUPAC name of 2-(benzotriazol-2-yl)-4,6-dibutylphenol (CID 12837390) is 2-(benzotriazol-2-yl)-4,6-dibutylphenol.
What is the SMILES notation for 2-(benzotriazol-2-yl)-4,6-dibutylphenol?
The canonical SMILES for 2-(benzotriazol-2-yl)-4,6-dibutylphenol is CCCCc1cc(CCCC)c(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of 2-(benzotriazol-2-yl)-4,6-dibutylphenol?
The InChIKey is IJLQBCRKBCAKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-3-5-9-15-13-16(10-6-4-2)20(24)19(14-15)23-21-17-11-7-8-12-18(17)22-23/h7-8,11-14,24H,3-6,9-10H2,1-2H3.
What are the key properties of 2-(benzotriazol-2-yl)-4,6-dibutylphenol?
2-(benzotriazol-2-yl)-4,6-dibutylphenol has a molecular weight of 323.44 g/mol, XLogP of 4.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-4,6-dibutylphenol is sourced from PubChem (CID 12837390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).