About benzene-1,2,4,5-tetracarbonitrile
benzene-1,2,4,5-tetracarbonitrile (PubChem CID 12838) has the molecular formula C10H2N4
and a molecular weight of 178.15 g/mol. Its IUPAC name is benzene-1,2,4,5-tetracarbonitrile.
Molecular Properties
| Compound Name | benzene-1,2,4,5-tetracarbonitrile |
| PubChem CID | 12838 |
| Molecular Formula | C10H2N4 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | benzene-1,2,4,5-tetracarbonitrile |
| SMILES | N#Cc1cc(C#N)c(C#N)cc1C#N |
| InChI | InChI=1S/C10H2N4/c11-3-7-1-8(4-12)10(6-14)2-9(7)5-13/h1-2H |
| InChIKey | FAAXSAZENACQBT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene-1,2,4,5-tetracarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,4,5-tetracarbonitrile?
The IUPAC name of benzene-1,2,4,5-tetracarbonitrile (CID 12838) is benzene-1,2,4,5-tetracarbonitrile.
What is the SMILES notation for benzene-1,2,4,5-tetracarbonitrile?
The canonical SMILES for benzene-1,2,4,5-tetracarbonitrile is N#Cc1cc(C#N)c(C#N)cc1C#N.
What is the InChIKey of benzene-1,2,4,5-tetracarbonitrile?
The InChIKey is FAAXSAZENACQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H2N4/c11-3-7-1-8(4-12)10(6-14)2-9(7)5-13/h1-2H.
What are the key properties of benzene-1,2,4,5-tetracarbonitrile?
benzene-1,2,4,5-tetracarbonitrile has a molecular weight of 178.15 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,4,5-tetracarbonitrile is sourced from PubChem (CID 12838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).