About 2-ethoxydecane
2-ethoxydecane (PubChem CID 12838329) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 2-ethoxydecane.
Molecular Properties
| Compound Name | 2-ethoxydecane |
| PubChem CID | 12838329 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 2-ethoxydecane |
| SMILES | CCCCCCCCC(C)OCC |
| InChI | InChI=1S/C12H26O/c1-4-6-7-8-9-10-11-12(3)13-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | CZMGLSVUJWHROB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxydecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxydecane?
The IUPAC name of 2-ethoxydecane (CID 12838329) is 2-ethoxydecane.
What is the SMILES notation for 2-ethoxydecane?
The canonical SMILES for 2-ethoxydecane is CCCCCCCCC(C)OCC.
What is the InChIKey of 2-ethoxydecane?
The InChIKey is CZMGLSVUJWHROB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O/c1-4-6-7-8-9-10-11-12(3)13-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 2-ethoxydecane?
2-ethoxydecane has a molecular weight of 186.34 g/mol, XLogP of 4.16, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxydecane is sourced from PubChem (CID 12838329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).