About 1,5-diphenylpentan-3-ol
1,5-diphenylpentan-3-ol (PubChem CID 12838510) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1,5-diphenylpentan-3-ol.
Molecular Properties
| Compound Name | 1,5-diphenylpentan-3-ol |
| PubChem CID | 12838510 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1,5-diphenylpentan-3-ol |
| SMILES | OC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C17H20O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | YDNNOTNUWKPRNH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-diphenylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenylpentan-3-ol?
The IUPAC name of 1,5-diphenylpentan-3-ol (CID 12838510) is 1,5-diphenylpentan-3-ol.
What is the SMILES notation for 1,5-diphenylpentan-3-ol?
The canonical SMILES for 1,5-diphenylpentan-3-ol is OC(CCc1ccccc1)CCc1ccccc1.
What is the InChIKey of 1,5-diphenylpentan-3-ol?
The InChIKey is YDNNOTNUWKPRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2.
What are the key properties of 1,5-diphenylpentan-3-ol?
1,5-diphenylpentan-3-ol has a molecular weight of 240.35 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenylpentan-3-ol is sourced from PubChem (CID 12838510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).